asdjaklskjturil asdjaklskjturil

16-01-2018
Mathematics

contestada

how do you write the expression as an angle sin42cos17-cos42sin17

Respuesta :

16-01-2018

sin(a+b)=sin(a)cos(b)+cos(a)sin(b).
Let a=42 and b=17 so sin(42+17)=sin59.

Answer Link

Otras preguntas

HELP PLEASE WITH 1 AND 2 1. Simplify the following expression 2.given the following equation solve for a. (Assume a,b and c are positive real numbers)

f(g) = 895 + 30gwhere g represents the number of times he played golf during the year. Last year he paid $ 2,065 as a total golfing fee. For how many games did

what is 2.1 rounded to the nearest tenth?

How do bacteria that live deep below the ocean’s surface make food? a. by cellular respiration b. by chemosynthesis c. by photosynthesis d. They eat other organ

Luanne made a photocopy of a drawing of a rectangle. The original drawing was 4.5 inches wide and 6 inches long. The copy was 6.75 inches wide and 9 inches long

a chemical spill has just killed off all the algae in a part of the open ocean. how will this affect the food webs in that part?

what is 2.1 rounded to the nearest tenth?

Write an algebraic expression for two fifths the cube of a number

solve for x of (8x+30)°(4x+18)°

If I work then I earn money, but if I'm idle, then I enjoy myself. Either I work or I'm idle. However, if I work, then I do not enjoy myself, while if I'm idle,