rpereinarob121 rpereinarob121

15-11-2016
English

contestada

who was the first president of the united states?

Respuesta :

Аноним Аноним

15-11-2016

George Washington<<<<<<<<<<<<<<<<<<<<<<

Answer Link

Ammimochi Ammimochi

15-11-2016

George Washington was the first president of the United States.

Answer Link

Otras preguntas

a student tested diet crispbreads in an investigation. The temperature rise per gram was 1.0°C. What is the ratio of temperatue rise caused by the crispbreads c

PLEASE HELP ASAP!!!!!

why does a country require skilled human resources describe

why no religious festival or practise is allowed in government run institution

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

Write the message conveyed in the story 'The cop and the anthem'

What is the surface area of the following solid figure? 42 in. 2 62 in. 2 68 in. 2 59 in. 2

You are wondering if food source alone was driving the pine and oak jay groups to have different bill lengths. Therefore, you decide to investigate if the jays

What were the author's purposes in writing It's Our World, Too!: Young People Who Are Making a Difference? Check all that apply to entertain readers with the an

what’s the equation of the blue line?