abbymartinez559 abbymartinez559

14-11-2022
Chemistry

contestada

A 345. g sample of an unknown substance was heated from 45.0°C to 167.7°C. In the process, the substance absorbed 18.942 kJ of energy. What is the specific heat of the substance? Give your answer in both standard and scientific notation.
Was this an endothermic or exothermic process?

Respuesta :

Otras preguntas

(4, 1) under the transformation T : (x, y) → (x + 3, y + 1)

what are the slope and y-intercept -3x-8y=10

What factor most influence the rate of molecular movement into a cell?

Show that cos(A+45)=cos45(cosA-sinA)

Which statement is true

Lucia would like to survey a sample of students about their favorite colors. What is the best way Lucia could select the sample? randomly select some students f

what is the difference between a book report and a summary ???? please help greatly needed.

During resistance exercise muscles are

what is 4(2(329)) LIKE i have no idea how to do that

5. Compare the parent function f(x) = x 2 to the quadratic function f(x) = –2x 2 – 6. The 6 in the function does which of the following? (1 point) It makes the